C20H32O6 — CID 139918119
dipropyl (4R,5R)-2-(2,6-dimethylhepta-1,5-dienyl)-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 139918119) has the molecular formula C20H32O6 and a molecular weight of 368.47 g/mol. Its IUPAC name is dipropyl (4R,5R)-2-(2,6-dimethylhepta-1,5-dienyl)-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dipropyl (4R,5R)-2-(2,6-dimethylhepta-1,5-dienyl)-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 139918119 |
| Molecular Formula | C20H32O6 |
| Molecular Weight | 368.47 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | dipropyl (4R,5R)-2-(2,6-dimethylhepta-1,5-dienyl)-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | CCCOC(=O)[C@@H]1OC(C=C(C)CCC=C(C)C)O[C@H]1C(=O)OCCC |
| InChI | InChI=1S/C20H32O6/c1-6-11-23-19(21)17-18(20(22)24-12-7-2)26-16(25-17)13-15(5)10-8-9-14(3)4/h9,13,16-18H,6-8,10-12H2,1-5H3/t17-,18-/m1/s1 |
| InChIKey | KIPUQDBCJBGLJS-QZTJIDSGSA-N |
| XLogP | 3.70 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.47 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|