C16H24O6 — CID 139918117
dimethyl (4R,5R)-2-(2,6-dimethylhepta-1,5-dienyl)-1,3-dioxolane-4,5-dicarboxylate (PubChem CID 139918117) has the molecular formula C16H24O6 and a molecular weight of 312.36 g/mol. Its IUPAC name is dimethyl (4R,5R)-2-(2,6-dimethylhepta-1,5-dienyl)-1,3-dioxolane-4,5-dicarboxylate.
| Compound Name | dimethyl (4R,5R)-2-(2,6-dimethylhepta-1,5-dienyl)-1,3-dioxolane-4,5-dicarboxylate |
|---|---|
| PubChem CID | 139918117 |
| Molecular Formula | C16H24O6 |
| Molecular Weight | 312.36 g/mol |
| Exact Mass | 312.16 |
| IUPAC Name | dimethyl (4R,5R)-2-(2,6-dimethylhepta-1,5-dienyl)-1,3-dioxolane-4,5-dicarboxylate |
| SMILES | COC(=O)[C@@H]1OC(C=C(C)CCC=C(C)C)O[C@H]1C(=O)OC |
| InChI | InChI=1S/C16H24O6/c1-10(2)7-6-8-11(3)9-12-21-13(15(17)19-4)14(22-12)16(18)20-5/h7,9,12-14H,6,8H2,1-5H3/t13-,14-/m1/s1 |
| InChIKey | LICWGRYYYSMVBE-ZIAGYGMSSA-N |
| XLogP | 2.14 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.36 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|