C15H24O3 — CID 12742943
methyl (4Z)-2-acetyl-5,9-dimethyldeca-4,8-dienoate (PubChem CID 12742943) has the molecular formula C15H24O3 and a molecular weight of 252.35 g/mol. Its IUPAC name is methyl (4Z)-2-acetyl-5,9-dimethyldeca-4,8-dienoate.
| Compound Name | methyl (4Z)-2-acetyl-5,9-dimethyldeca-4,8-dienoate |
|---|---|
| PubChem CID | 12742943 |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17 |
| IUPAC Name | methyl (4Z)-2-acetyl-5,9-dimethyldeca-4,8-dienoate |
| SMILES | COC(=O)C(C/C=C(/C)CCC=C(C)C)C(C)=O |
| InChI | InChI=1S/C15H24O3/c1-11(2)7-6-8-12(3)9-10-14(13(4)16)15(17)18-5/h7,9,14H,6,8,10H2,1-5H3/b12-9- |
| InChIKey | BSTPZJQNOMFGJU-XFXZXTDPSA-N |
| XLogP | 3.45 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.35 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|