C20H26O2 — CID 10063286
2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-phenylbutane-1,3-dione (PubChem CID 10063286) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-phenylbutane-1,3-dione.
| Compound Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-phenylbutane-1,3-dione |
|---|---|
| PubChem CID | 10063286 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | 2-[(2E)-3,7-dimethylocta-2,6-dienyl]-1-phenylbutane-1,3-dione |
| SMILES | CC(=O)C(C/C=C(\C)CCC=C(C)C)C(=O)c1ccccc1 |
| InChI | InChI=1S/C20H26O2/c1-15(2)9-8-10-16(3)13-14-19(17(4)21)20(22)18-11-6-5-7-12-18/h5-7,9,11-13,19H,8,10,14H2,1-4H3/b16-13+ |
| InChIKey | IGBYBDXDOWPEHG-DTQAZKPQSA-N |
| XLogP | 5.16 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|