C29H42O4 — CID 78104769
ethyl 2-(furan-3-carbonyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate (PubChem CID 78104769) has the molecular formula C29H42O4 and a molecular weight of 454.65 g/mol. Its IUPAC name is ethyl 2-(furan-3-carbonyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate.
| Compound Name | ethyl 2-(furan-3-carbonyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate |
|---|---|
| PubChem CID | 78104769 |
| Molecular Formula | C29H42O4 |
| Molecular Weight | 454.65 g/mol |
| Exact Mass | 454.31 |
| IUPAC Name | ethyl 2-(furan-3-carbonyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate |
| SMILES | CCOC(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)c1ccoc1 |
| InChI | InChI=1S/C29H42O4/c1-7-33-29(31)27(28(30)26-19-20-32-21-26)18-17-25(6)16-10-15-24(5)14-9-13-23(4)12-8-11-22(2)3/h11,13,15,17,19-21,27H,7-10,12,14,16,18H2,1-6H3 |
| InChIKey | CGKCHTXJKJPPFW-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 56.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.65 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|