C28H44O3 — CID 123932322
ethyl 2-(cyclopropanecarbonyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate (PubChem CID 123932322) has the molecular formula C28H44O3 and a molecular weight of 428.66 g/mol. Its IUPAC name is ethyl 2-(cyclopropanecarbonyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate.
| Compound Name | ethyl 2-(cyclopropanecarbonyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate |
|---|---|
| PubChem CID | 123932322 |
| Molecular Formula | C28H44O3 |
| Molecular Weight | 428.66 g/mol |
| Exact Mass | 428.33 |
| IUPAC Name | ethyl 2-(cyclopropanecarbonyl)-5,9,13,17-tetramethyloctadeca-4,8,12,16-tetraenoate |
| SMILES | CCOC(=O)C(CC=C(C)CCC=C(C)CCC=C(C)CCC=C(C)C)C(=O)C1CC1 |
| InChI | InChI=1S/C28H44O3/c1-7-31-28(30)26(27(29)25-18-19-25)20-17-24(6)16-10-15-23(5)14-9-13-22(4)12-8-11-21(2)3/h11,13,15,17,25-26H,7-10,12,14,16,18-20H2,1-6H3 |
| InChIKey | MZPNMEMGGVJKGA-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.66 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|