C21H34O3 — CID 10969697
ethyl (6E,10E)-7,11,15-trimethyl-3-oxohexadeca-6,10,14-trienoate (PubChem CID 10969697) has the molecular formula C21H34O3 and a molecular weight of 334.50 g/mol. Its IUPAC name is ethyl (6E,10E)-7,11,15-trimethyl-3-oxohexadeca-6,10,14-trienoate.
| Compound Name | ethyl (6E,10E)-7,11,15-trimethyl-3-oxohexadeca-6,10,14-trienoate |
|---|---|
| PubChem CID | 10969697 |
| Molecular Formula | C21H34O3 |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.25 |
| IUPAC Name | ethyl (6E,10E)-7,11,15-trimethyl-3-oxohexadeca-6,10,14-trienoate |
| SMILES | CCOC(=O)CC(=O)CC/C=C(\C)CC/C=C(\C)CCC=C(C)C |
| InChI | InChI=1S/C21H34O3/c1-6-24-21(23)16-20(22)15-9-14-19(5)13-8-12-18(4)11-7-10-17(2)3/h10,12,14H,6-9,11,13,15-16H2,1-5H3/b18-12+,19-14+ |
| InChIKey | JDITVCKWSUFDMU-IJNKXORISA-N |
| XLogP | 5.71 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|