C30H39NO2 — CID 154720217
3-anilino-1-phenyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propan-1-one (PubChem CID 154720217) has the molecular formula C30H39NO2 and a molecular weight of 445.65 g/mol. Its IUPAC name is 3-anilino-1-phenyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propan-1-one.
| Compound Name | 3-anilino-1-phenyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propan-1-one |
|---|---|
| PubChem CID | 154720217 |
| Molecular Formula | C30H39NO2 |
| Molecular Weight | 445.65 g/mol |
| Exact Mass | 445.30 |
| IUPAC Name | 3-anilino-1-phenyl-2-[(2E,6E)-3,7,11-trimethyldodeca-2,6,10-trienoxy]propan-1-one |
| SMILES | CC(C)=CCC/C(C)=C/CC/C(C)=C/COC(CNc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C30H39NO2/c1-24(2)13-11-14-25(3)15-12-16-26(4)21-22-33-29(23-31-28-19-9-6-10-20-28)30(32)27-17-7-5-8-18-27/h5-10,13,15,17-21,29,31H,11-12,14,16,22-23H2,1-4H3/b25-15+,26-21+ |
| InChIKey | DRUWFAGGGZBFGF-QZELQNEBSA-N |
| XLogP | 7.79 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.65 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|