C22H31NO2 — CID 67762934
4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid (PubChem CID 67762934) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid.
| Compound Name | 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid |
|---|---|
| PubChem CID | 67762934 |
| Molecular Formula | C22H31NO2 |
| Molecular Weight | 341.50 g/mol |
| Exact Mass | 341.24 |
| IUPAC Name | 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid |
| SMILES | CC(C)=CCCC(C)=CCCC(C)=CCNc1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C22H31NO2/c1-17(2)7-5-8-18(3)9-6-10-19(4)15-16-23-21-13-11-20(12-14-21)22(24)25/h7,9,11-15,23H,5-6,8,10,16H2,1-4H3,(H,24,25) |
| InChIKey | CFSRSGZDZMMGPX-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.50 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|