4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid

C22H31NO2 — CID 67762934

IUPAC4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid
SMILESCC(C)=CCCC(C)=CCCC(C)=CCNc1ccc(C(=O)O)cc1
InChIInChI=1S/C22H31NO2/c1-17(2)7-5-8-18(3)9-6-10-19(4)15-16-23-21-13-11-20(12-14-21)22(24)25/h7,9,11-15,23H,5-6,8,10,16H2,1-4H3,(H,24,25)
InChIKeyCFSRSGZDZMMGPX-UHFFFAOYSA-N
MW341.50 g/mol
LogP6.22
Rot. Bonds10

About 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid

4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid (PubChem CID 67762934) has the molecular formula C22H31NO2 and a molecular weight of 341.50 g/mol. Its IUPAC name is 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid.

Molecular Properties

Compound Name4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid
PubChem CID67762934
Molecular FormulaC22H31NO2
Molecular Weight341.50 g/mol
Exact Mass341.24
IUPAC Name4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid
SMILESCC(C)=CCCC(C)=CCCC(C)=CCNc1ccc(C(=O)O)cc1
InChIInChI=1S/C22H31NO2/c1-17(2)7-5-8-18(3)9-6-10-19(4)15-16-23-21-13-11-20(12-14-21)22(24)25/h7,9,11-15,23H,5-6,8,10,16H2,1-4H3,(H,24,25)
InChIKeyCFSRSGZDZMMGPX-UHFFFAOYSA-N
XLogP6.22
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds10
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500341.50
LogP ≤ 56.22
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid?
The IUPAC name of 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid (CID 67762934) is 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid.
What is the SMILES notation for 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid?
The canonical SMILES for 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid is CC(C)=CCCC(C)=CCCC(C)=CCNc1ccc(C(=O)O)cc1.
What is the InChIKey of 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid?
The InChIKey is CFSRSGZDZMMGPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H31NO2/c1-17(2)7-5-8-18(3)9-6-10-19(4)15-16-23-21-13-11-20(12-14-21)22(24)25/h7,9,11-15,23H,5-6,8,10,16H2,1-4H3,(H,24,25).
What are the key properties of 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid?
4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid has a molecular weight of 341.50 g/mol, XLogP of 6.22, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(3,7,11-trimethyldodeca-2,6,10-trienylamino)benzoic acid is sourced from PubChem (CID 67762934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).