C28H37N2NaO3 — CID 102092934
sodium 4-[4-[4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoate (PubChem CID 102092934) has the molecular formula C28H37N2NaO3 and a molecular weight of 472.61 g/mol. Its IUPAC name is sodium 4-[4-[4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoate.
| Compound Name | sodium 4-[4-[4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoate |
|---|---|
| PubChem CID | 102092934 |
| Molecular Formula | C28H37N2NaO3 |
| Molecular Weight | 472.61 g/mol |
| Exact Mass | 472.27 |
| IUPAC Name | sodium 4-[4-[4-[[(2E)-3,7-dimethylocta-2,6-dienyl]amino]benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoate |
| SMILES | CCc1c(C(=O)c2ccc(NC/C=C(\C)CCC=C(C)C)cc2)cc(CCCC(=O)[O-])n1C.[Na+] |
| InChI | InChI=1S/C28H38N2O3.Na/c1-6-26-25(19-24(30(26)5)11-8-12-27(31)32)28(33)22-13-15-23(16-14-22)29-18-17-21(4)10-7-9-20(2)3;/h9,13-17,19,29H,6-8,10-12,18H2,1-5H3,(H,31,32);/q;+1/p-1/b21-17+; |
| InChIKey | LKZLKGSLTYACSG-DIRYEVLESA-M |
| XLogP | 2.00 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.61 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|