C32H34N2O3 — CID 139750261
4-[4-[3-(2,2-diphenylethylamino)benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoic acid (PubChem CID 139750261) has the molecular formula C32H34N2O3 and a molecular weight of 494.64 g/mol. Its IUPAC name is 4-[4-[3-(2,2-diphenylethylamino)benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoic acid.
| Compound Name | 4-[4-[3-(2,2-diphenylethylamino)benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoic acid |
|---|---|
| PubChem CID | 139750261 |
| Molecular Formula | C32H34N2O3 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.26 |
| IUPAC Name | 4-[4-[3-(2,2-diphenylethylamino)benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoic acid |
| SMILES | CCc1c(C(=O)c2cccc(NCC(c3ccccc3)c3ccccc3)c2)cc(CCCC(=O)O)n1C |
| InChI | InChI=1S/C32H34N2O3/c1-3-30-28(21-27(34(30)2)18-11-19-31(35)36)32(37)25-16-10-17-26(20-25)33-22-29(23-12-6-4-7-13-23)24-14-8-5-9-15-24/h4-10,12-17,20-21,29,33H,3,11,18-19,22H2,1-2H3,(H,35,36) |
| InChIKey | LPSLCZHAFOOZFQ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |