C24H34N2O3 — CID 139750142
ethyl 4-[4-[3-(butylamino)benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoate (PubChem CID 139750142) has the molecular formula C24H34N2O3 and a molecular weight of 398.55 g/mol. Its IUPAC name is ethyl 4-[4-[3-(butylamino)benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoate.
| Compound Name | ethyl 4-[4-[3-(butylamino)benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoate |
|---|---|
| PubChem CID | 139750142 |
| Molecular Formula | C24H34N2O3 |
| Molecular Weight | 398.55 g/mol |
| Exact Mass | 398.26 |
| IUPAC Name | ethyl 4-[4-[3-(butylamino)benzoyl]-5-ethyl-1-methylpyrrol-2-yl]butanoate |
| SMILES | CCCCNc1cccc(C(=O)c2cc(CCCC(=O)OCC)n(C)c2CC)c1 |
| InChI | InChI=1S/C24H34N2O3/c1-5-8-15-25-19-12-9-11-18(16-19)24(28)21-17-20(26(4)22(21)6-2)13-10-14-23(27)29-7-3/h9,11-12,16-17,25H,5-8,10,13-15H2,1-4H3 |
| InChIKey | RIUSZKAJCWRSIG-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 60.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.55 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|