C31H41N3O4 — CID 19010763
ethyl 4-[1-[3-[[1-(heptylamino)-1-oxopropan-2-yl]amino]benzoyl]indolizin-3-yl]butanoate (PubChem CID 19010763) has the molecular formula C31H41N3O4 and a molecular weight of 519.69 g/mol. Its IUPAC name is ethyl 4-[1-[3-[[1-(heptylamino)-1-oxopropan-2-yl]amino]benzoyl]indolizin-3-yl]butanoate.
| Compound Name | ethyl 4-[1-[3-[[1-(heptylamino)-1-oxopropan-2-yl]amino]benzoyl]indolizin-3-yl]butanoate |
|---|---|
| PubChem CID | 19010763 |
| Molecular Formula | C31H41N3O4 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.31 |
| IUPAC Name | ethyl 4-[1-[3-[[1-(heptylamino)-1-oxopropan-2-yl]amino]benzoyl]indolizin-3-yl]butanoate |
| SMILES | CCCCCCCNC(=O)C(C)Nc1cccc(C(=O)c2cc(CCCC(=O)OCC)n3ccccc23)c1 |
| InChI | InChI=1S/C31H41N3O4/c1-4-6-7-8-10-19-32-31(37)23(3)33-25-15-12-14-24(21-25)30(36)27-22-26(16-13-18-29(35)38-5-2)34-20-11-9-17-28(27)34/h9,11-12,14-15,17,20-23,33H,4-8,10,13,16,18-19H2,1-3H3,(H,32,37) |
| InChIKey | WJVQGAJJEMCZRS-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|