C21H22N2O3 — CID 10904244
ethyl 4-[1-(3-aminobenzoyl)indolizin-3-yl]butanoate (PubChem CID 10904244) has the molecular formula C21H22N2O3 and a molecular weight of 350.42 g/mol. Its IUPAC name is ethyl 4-[1-(3-aminobenzoyl)indolizin-3-yl]butanoate.
| Compound Name | ethyl 4-[1-(3-aminobenzoyl)indolizin-3-yl]butanoate |
|---|---|
| PubChem CID | 10904244 |
| Molecular Formula | C21H22N2O3 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | ethyl 4-[1-(3-aminobenzoyl)indolizin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCc1cc(C(=O)c2cccc(N)c2)c2ccccn12 |
| InChI | InChI=1S/C21H22N2O3/c1-2-26-20(24)11-6-9-17-14-18(19-10-3-4-12-23(17)19)21(25)15-7-5-8-16(22)13-15/h3-5,7-8,10,12-14H,2,6,9,11,22H2,1H3 |
| InChIKey | SNJUYCKZFCNJKC-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 73.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|