C33H35NO3 — CID 70278301
ethyl 4-[1-[3-[(Z)-2-[4-(2-methylpropyl)phenyl]ethenyl]benzoyl]indolizin-3-yl]butanoate (PubChem CID 70278301) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is ethyl 4-[1-[3-[(Z)-2-[4-(2-methylpropyl)phenyl]ethenyl]benzoyl]indolizin-3-yl]butanoate.
| Compound Name | ethyl 4-[1-[3-[(Z)-2-[4-(2-methylpropyl)phenyl]ethenyl]benzoyl]indolizin-3-yl]butanoate |
|---|---|
| PubChem CID | 70278301 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | ethyl 4-[1-[3-[(Z)-2-[4-(2-methylpropyl)phenyl]ethenyl]benzoyl]indolizin-3-yl]butanoate |
| SMILES | CCOC(=O)CCCc1cc(C(=O)c2cccc(/C=C\c3ccc(CC(C)C)cc3)c2)c2ccccn12 |
| InChI | InChI=1S/C33H35NO3/c1-4-37-32(35)13-8-11-29-23-30(31-12-5-6-20-34(29)31)33(36)28-10-7-9-26(22-28)17-14-25-15-18-27(19-16-25)21-24(2)3/h5-7,9-10,12,14-20,22-24H,4,8,11,13,21H2,1-3H3/b17-14- |
| InChIKey | ZCGGTIYTUBGUDM-VKAVYKQESA-N |
| XLogP | 7.43 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|