C43H50N2O3 — CID 19024845
ethyl 4-[3-[3-[bis[4-(2-methylpropyl)phenyl]methyl-methylamino]benzoyl]indol-1-yl]butanoate (PubChem CID 19024845) has the molecular formula C43H50N2O3 and a molecular weight of 642.88 g/mol. Its IUPAC name is ethyl 4-[3-[3-[bis[4-(2-methylpropyl)phenyl]methyl-methylamino]benzoyl]indol-1-yl]butanoate.
| Compound Name | ethyl 4-[3-[3-[bis[4-(2-methylpropyl)phenyl]methyl-methylamino]benzoyl]indol-1-yl]butanoate |
|---|---|
| PubChem CID | 19024845 |
| Molecular Formula | C43H50N2O3 |
| Molecular Weight | 642.88 g/mol |
| Exact Mass | 642.38 |
| IUPAC Name | ethyl 4-[3-[3-[bis[4-(2-methylpropyl)phenyl]methyl-methylamino]benzoyl]indol-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1cc(C(=O)c2cccc(N(C)C(c3ccc(CC(C)C)cc3)c3ccc(CC(C)C)cc3)c2)c2ccccc21 |
| InChI | InChI=1S/C43H50N2O3/c1-7-48-41(46)16-11-25-45-29-39(38-14-8-9-15-40(38)45)43(47)36-12-10-13-37(28-36)44(6)42(34-21-17-32(18-22-34)26-30(2)3)35-23-19-33(20-24-35)27-31(4)5/h8-10,12-15,17-24,28-31,42H,7,11,16,25-27H2,1-6H3 |
| InChIKey | OAGMKDDUZUKYSE-UHFFFAOYSA-N |
| XLogP | 9.84 |
| TPSA | 51.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.88 |
| LogP ≤ 5 | 9.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |