C37H45NO4 — CID 10897067
ethyl 4-[3-[4-[1-[4-(2-methylpropyl)phenyl]hexoxy]benzoyl]indol-1-yl]butanoate (PubChem CID 10897067) has the molecular formula C37H45NO4 and a molecular weight of 567.77 g/mol. Its IUPAC name is ethyl 4-[3-[4-[1-[4-(2-methylpropyl)phenyl]hexoxy]benzoyl]indol-1-yl]butanoate.
| Compound Name | ethyl 4-[3-[4-[1-[4-(2-methylpropyl)phenyl]hexoxy]benzoyl]indol-1-yl]butanoate |
|---|---|
| PubChem CID | 10897067 |
| Molecular Formula | C37H45NO4 |
| Molecular Weight | 567.77 g/mol |
| Exact Mass | 567.33 |
| IUPAC Name | ethyl 4-[3-[4-[1-[4-(2-methylpropyl)phenyl]hexoxy]benzoyl]indol-1-yl]butanoate |
| SMILES | CCCCCC(Oc1ccc(C(=O)c2cn(CCCC(=O)OCC)c3ccccc23)cc1)c1ccc(CC(C)C)cc1 |
| InChI | InChI=1S/C37H45NO4/c1-5-7-8-14-35(29-18-16-28(17-19-29)25-27(3)4)42-31-22-20-30(21-23-31)37(40)33-26-38(24-11-15-36(39)41-6-2)34-13-10-9-12-32(33)34/h9-10,12-13,16-23,26-27,35H,5-8,11,14-15,24-25H2,1-4H3 |
| InChIKey | MDPOBRKAYBUDFE-UHFFFAOYSA-N |
| XLogP | 9.11 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.77 |
| LogP ≤ 5 | 9.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|