C32H34ClNO4 — CID 54278881
ethyl 4-[3-[4-[1-(4-chlorophenyl)pentoxy]benzoyl]indol-1-yl]butanoate (PubChem CID 54278881) has the molecular formula C32H34ClNO4 and a molecular weight of 532.08 g/mol. Its IUPAC name is ethyl 4-[3-[4-[1-(4-chlorophenyl)pentoxy]benzoyl]indol-1-yl]butanoate.
| Compound Name | ethyl 4-[3-[4-[1-(4-chlorophenyl)pentoxy]benzoyl]indol-1-yl]butanoate |
|---|---|
| PubChem CID | 54278881 |
| Molecular Formula | C32H34ClNO4 |
| Molecular Weight | 532.08 g/mol |
| Exact Mass | 531.22 |
| IUPAC Name | ethyl 4-[3-[4-[1-(4-chlorophenyl)pentoxy]benzoyl]indol-1-yl]butanoate |
| SMILES | CCCCC(Oc1ccc(C(=O)c2cn(CCCC(=O)OCC)c3ccccc23)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C32H34ClNO4/c1-3-5-11-30(23-13-17-25(33)18-14-23)38-26-19-15-24(16-20-26)32(36)28-22-34(21-8-12-31(35)37-4-2)29-10-7-6-9-27(28)29/h6-7,9-10,13-20,22,30H,3-5,8,11-12,21H2,1-2H3 |
| InChIKey | RPJKJAZJRHZUKR-UHFFFAOYSA-N |
| XLogP | 8.18 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.08 |
| LogP ≤ 5 | 8.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |