C43H49NO3 — CID 19024837
ethyl 4-[3-[4-[2,2-bis[4-(2-methylpropyl)phenyl]ethyl]benzoyl]indol-1-yl]butanoate (PubChem CID 19024837) has the molecular formula C43H49NO3 and a molecular weight of 627.87 g/mol. Its IUPAC name is ethyl 4-[3-[4-[2,2-bis[4-(2-methylpropyl)phenyl]ethyl]benzoyl]indol-1-yl]butanoate.
| Compound Name | ethyl 4-[3-[4-[2,2-bis[4-(2-methylpropyl)phenyl]ethyl]benzoyl]indol-1-yl]butanoate |
|---|---|
| PubChem CID | 19024837 |
| Molecular Formula | C43H49NO3 |
| Molecular Weight | 627.87 g/mol |
| Exact Mass | 627.37 |
| IUPAC Name | ethyl 4-[3-[4-[2,2-bis[4-(2-methylpropyl)phenyl]ethyl]benzoyl]indol-1-yl]butanoate |
| SMILES | CCOC(=O)CCCn1cc(C(=O)c2ccc(CC(c3ccc(CC(C)C)cc3)c3ccc(CC(C)C)cc3)cc2)c2ccccc21 |
| InChI | InChI=1S/C43H49NO3/c1-6-47-42(45)12-9-25-44-29-40(38-10-7-8-11-41(38)44)43(46)37-23-17-34(18-24-37)28-39(35-19-13-32(14-20-35)26-30(2)3)36-21-15-33(16-22-36)27-31(4)5/h7-8,10-11,13-24,29-31,39H,6,9,12,25-28H2,1-5H3 |
| InChIKey | WPXJJJJIUUMIGE-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 48.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.87 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |