ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate

C25H23NO3 — CID 72948236

IUPACethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate
SMILESCCOC(=O)CCCn1cc(C(=O)c2cccc3ccccc23)c2ccccc21
InChIInChI=1S/C25H23NO3/c1-2-29-24(27)15-8-16-26-17-22(20-12-5-6-14-23(20)26)25(28)21-13-7-10-18-9-3-4-11-19(18)21/h3-7,9-14,17H,2,8,15-16H2,1H3
InChIKeyKVNIUKCERQTNHV-UHFFFAOYSA-N
MW385.46 g/mol
LogP5.37
Rot. Bonds7

About ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate

ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate (PubChem CID 72948236) has the molecular formula C25H23NO3 and a molecular weight of 385.46 g/mol. Its IUPAC name is ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate.

Molecular Properties

Compound Nameethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate
PubChem CID72948236
Molecular FormulaC25H23NO3
Molecular Weight385.46 g/mol
Exact Mass385.17
IUPAC Nameethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate
SMILESCCOC(=O)CCCn1cc(C(=O)c2cccc3ccccc23)c2ccccc21
InChIInChI=1S/C25H23NO3/c1-2-29-24(27)15-8-16-26-17-22(20-12-5-6-14-23(20)26)25(28)21-13-7-10-18-9-3-4-11-19(18)21/h3-7,9-14,17H,2,8,15-16H2,1H3
InChIKeyKVNIUKCERQTNHV-UHFFFAOYSA-N
XLogP5.37
TPSA48.30 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds7
Heavy Atoms29
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500385.46
LogP ≤ 55.37
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Analyze ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate?
The IUPAC name of ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate (CID 72948236) is ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate.
What is the SMILES notation for ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate?
The canonical SMILES for ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate is CCOC(=O)CCCn1cc(C(=O)c2cccc3ccccc23)c2ccccc21.
What is the InChIKey of ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate?
The InChIKey is KVNIUKCERQTNHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H23NO3/c1-2-29-24(27)15-8-16-26-17-22(20-12-5-6-14-23(20)26)25(28)21-13-7-10-18-9-3-4-11-19(18)21/h3-7,9-14,17H,2,8,15-16H2,1H3.
What are the key properties of ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate?
ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate has a molecular weight of 385.46 g/mol, XLogP of 5.37, 7 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[3-(naphthalene-1-carbonyl)indol-1-yl]butanoate is sourced from PubChem (CID 72948236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).