C24H22ClNO — CID 125181380
[1-[(3S)-3-chloropentyl]indol-3-yl]-naphthalen-1-ylmethanone (PubChem CID 125181380) has the molecular formula C24H22ClNO and a molecular weight of 375.90 g/mol. Its IUPAC name is [1-[(3S)-3-chloropentyl]indol-3-yl]-naphthalen-1-ylmethanone.
| Compound Name | [1-[(3S)-3-chloropentyl]indol-3-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 125181380 |
| Molecular Formula | C24H22ClNO |
| Molecular Weight | 375.90 g/mol |
| Exact Mass | 375.14 |
| IUPAC Name | [1-[(3S)-3-chloropentyl]indol-3-yl]-naphthalen-1-ylmethanone |
| SMILES | CC[C@H](Cl)CCn1cc(C(=O)c2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C24H22ClNO/c1-2-18(25)14-15-26-16-22(20-11-5-6-13-23(20)26)24(27)21-12-7-9-17-8-3-4-10-19(17)21/h3-13,16,18H,2,14-15H2,1H3/t18-/m0/s1 |
| InChIKey | QCNUSOJQZULYQA-SFHVURJKSA-N |
| XLogP | 6.43 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.90 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|