C23H21NO — CID 53394763
[1-(2,2,3,3,4,4,4-heptadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone (PubChem CID 53394763) has the molecular formula C23H21NO and a molecular weight of 334.47 g/mol. Its IUPAC name is [1-(2,2,3,3,4,4,4-heptadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone.
| Compound Name | [1-(2,2,3,3,4,4,4-heptadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 53394763 |
| Molecular Formula | C23H21NO |
| Molecular Weight | 334.47 g/mol |
| Exact Mass | 334.21 |
| IUPAC Name | [1-(2,2,3,3,4,4,4-heptadeuteriobutyl)indol-3-yl]-naphthalen-1-ylmethanone |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])Cn1cc(C(=O)c2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C23H21NO/c1-2-3-15-24-16-21(19-12-6-7-14-22(19)24)23(25)20-13-8-10-17-9-4-5-11-18(17)20/h4-14,16H,2-3,15H2,1H3/i1D3,2D2,3D2 |
| InChIKey | VCHHHSMPMLNVGS-NCKGIQLSSA-N |
| XLogP | 5.83 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.47 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |