C25H25NO — CID 169442717
[2-methyl-1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indol-3-yl]-naphthalen-1-ylmethanone (PubChem CID 169442717) has the molecular formula C25H25NO and a molecular weight of 366.55 g/mol. Its IUPAC name is [2-methyl-1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indol-3-yl]-naphthalen-1-ylmethanone.
| Compound Name | [2-methyl-1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indol-3-yl]-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 169442717 |
| Molecular Formula | C25H25NO |
| Molecular Weight | 366.55 g/mol |
| Exact Mass | 366.26 |
| IUPAC Name | [2-methyl-1-(1,1,2,2,3,3,4,4,5,5,5-undecadeuteriopentyl)indol-3-yl]-naphthalen-1-ylmethanone |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])C([2H])([2H])n1c(C)c(C(=O)c2cccc3ccccc23)c2ccccc21 |
| InChI | InChI=1S/C25H25NO/c1-3-4-9-17-26-18(2)24(22-14-7-8-16-23(22)26)25(27)21-15-10-12-19-11-5-6-13-20(19)21/h5-8,10-16H,3-4,9,17H2,1-2H3/i1D3,3D2,4D2,9D2,17D2 |
| InChIKey | IBBNKINXTRKICJ-ANVOKOLHSA-N |
| XLogP | 6.52 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.55 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |