C18H16O2 — CID 65151492
naphthalen-1-yl-(2,4,5-trimethylfuran-3-yl)methanone (PubChem CID 65151492) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is naphthalen-1-yl-(2,4,5-trimethylfuran-3-yl)methanone.
| Compound Name | naphthalen-1-yl-(2,4,5-trimethylfuran-3-yl)methanone |
|---|---|
| PubChem CID | 65151492 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | naphthalen-1-yl-(2,4,5-trimethylfuran-3-yl)methanone |
| SMILES | Cc1oc(C)c(C(=O)c2cccc3ccccc23)c1C |
| InChI | InChI=1S/C18H16O2/c1-11-12(2)20-13(3)17(11)18(19)16-10-6-8-14-7-4-5-9-15(14)16/h4-10H,1-3H3 |
| InChIKey | KUXDNXMRUVOPNJ-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |