C15H11NO2 — CID 114282561
(2-methyl-1,3-oxazol-4-yl)-naphthalen-1-ylmethanone (PubChem CID 114282561) has the molecular formula C15H11NO2 and a molecular weight of 237.26 g/mol. Its IUPAC name is (2-methyl-1,3-oxazol-4-yl)-naphthalen-1-ylmethanone.
| Compound Name | (2-methyl-1,3-oxazol-4-yl)-naphthalen-1-ylmethanone |
|---|---|
| PubChem CID | 114282561 |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.26 g/mol |
| Exact Mass | 237.08 |
| IUPAC Name | (2-methyl-1,3-oxazol-4-yl)-naphthalen-1-ylmethanone |
| SMILES | Cc1nc(C(=O)c2cccc3ccccc23)co1 |
| InChI | InChI=1S/C15H11NO2/c1-10-16-14(9-18-10)15(17)13-8-4-6-11-5-2-3-7-12(11)13/h2-9H,1H3 |
| InChIKey | ZJFMXHQFKHUHJO-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.26 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |