About (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone
(2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone (PubChem CID 21432102) has the molecular formula C30H23NO2
and a molecular weight of 429.52 g/mol. Its IUPAC name is (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone.
Molecular Properties
| Compound Name | (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone |
| PubChem CID | 21432102 |
| Molecular Formula | C30H23NO2 |
| Molecular Weight | 429.52 g/mol |
| Exact Mass | 429.17 |
| IUPAC Name | (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone |
| SMILES | Cc1ccccc1C(=O)c1cccc2ccccc12.O=C(c1ccccc1)c1ccncc1 |
| InChI | InChI=1S/C18H14O.C12H9NO/c1-13-7-2-4-10-15(13)18(19)17-12-6-9-14-8-3-5-11-16(14)17;14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h2-12H,1H3;1-9H |
| InChIKey | VFMFALBXXZJGIG-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 429.52 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone?
The IUPAC name of (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone (CID 21432102) is (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone.
What is the SMILES notation for (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone?
The canonical SMILES for (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone is Cc1ccccc1C(=O)c1cccc2ccccc12.O=C(c1ccccc1)c1ccncc1.
What is the InChIKey of (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone?
The InChIKey is VFMFALBXXZJGIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14O.C12H9NO/c1-13-7-2-4-10-15(13)18(19)17-12-6-9-14-8-3-5-11-16(14)17;14-12(10-4-2-1-3-5-10)11-6-8-13-9-7-11/h2-12H,1H3;1-9H.
What are the key properties of (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone?
(2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone has a molecular weight of 429.52 g/mol, XLogP of 6.69, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)-naphthalen-1-ylmethanone;phenyl(pyridin-4-yl)methanone is sourced from PubChem (CID 21432102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).