About 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone
1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone (PubChem CID 143285715) has the molecular formula C17H19NO2
and a molecular weight of 269.34 g/mol. Its IUPAC name is 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone.
Molecular Properties
| Compound Name | 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone |
| PubChem CID | 143285715 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone |
| SMILES | CC(=O)CN.Cc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12O.C3H7NO/c1-11-7-5-6-10-13(11)14(15)12-8-3-2-4-9-12;1-3(5)2-4/h2-10H,1H3;2,4H2,1H3 |
| InChIKey | OCXUIDWPBQDQFE-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone?
The IUPAC name of 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone (CID 143285715) is 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone.
What is the SMILES notation for 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone?
The canonical SMILES for 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone is CC(=O)CN.Cc1ccccc1C(=O)c1ccccc1.
What is the InChIKey of 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone?
The InChIKey is OCXUIDWPBQDQFE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O.C3H7NO/c1-11-7-5-6-10-13(11)14(15)12-8-3-2-4-9-12;1-3(5)2-4/h2-10H,1H3;2,4H2,1H3.
What are the key properties of 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone?
1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone has a molecular weight of 269.34 g/mol, XLogP of 2.76, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminopropan-2-one;(2-methylphenyl)-phenylmethanone is sourced from PubChem (CID 143285715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).