C23H20O2 — CID 175001099
2-(2-benzoylphenyl)-1-(2,3-dimethylphenyl)ethanone (PubChem CID 175001099) has the molecular formula C23H20O2 and a molecular weight of 328.41 g/mol. Its IUPAC name is 2-(2-benzoylphenyl)-1-(2,3-dimethylphenyl)ethanone.
| Compound Name | 2-(2-benzoylphenyl)-1-(2,3-dimethylphenyl)ethanone |
|---|---|
| PubChem CID | 175001099 |
| Molecular Formula | C23H20O2 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-(2-benzoylphenyl)-1-(2,3-dimethylphenyl)ethanone |
| SMILES | Cc1cccc(C(=O)Cc2ccccc2C(=O)c2ccccc2)c1C |
| InChI | InChI=1S/C23H20O2/c1-16-9-8-14-20(17(16)2)22(24)15-19-12-6-7-13-21(19)23(25)18-10-4-3-5-11-18/h3-14H,15H2,1-2H3 |
| InChIKey | HZTOTQISFHWXOH-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |