About (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one
(2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one (PubChem CID 175125540) has the molecular formula C23H22O2
and a molecular weight of 330.43 g/mol. Its IUPAC name is (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one.
Molecular Properties
| Compound Name | (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one |
| PubChem CID | 175125540 |
| Molecular Formula | C23H22O2 |
| Molecular Weight | 330.43 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one |
| SMILES | CCC(=O)c1ccccc1.Cc1ccccc1C(=O)c1ccccc1 |
| InChI | InChI=1S/C14H12O.C9H10O/c1-11-7-5-6-10-13(11)14(15)12-8-3-2-4-9-12;1-2-9(10)8-6-4-3-5-7-8/h2-10H,1H3;3-7H,2H2,1H3 |
| InChIKey | WFQHGFAOYXIASG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 330.43 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one?
The IUPAC name of (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one (CID 175125540) is (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one.
What is the SMILES notation for (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one?
The canonical SMILES for (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one is CCC(=O)c1ccccc1.Cc1ccccc1C(=O)c1ccccc1.
What is the InChIKey of (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one?
The InChIKey is WFQHGFAOYXIASG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O.C9H10O/c1-11-7-5-6-10-13(11)14(15)12-8-3-2-4-9-12;1-2-9(10)8-6-4-3-5-7-8/h2-10H,1H3;3-7H,2H2,1H3.
What are the key properties of (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one?
(2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one has a molecular weight of 330.43 g/mol, XLogP of 5.51, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylphenyl)-phenylmethanone;1-phenylpropan-1-one is sourced from PubChem (CID 175125540), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).