About methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one
methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one (PubChem CID 160854599) has the molecular formula C20H22O4
and a molecular weight of 326.39 g/mol. Its IUPAC name is methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one.
Molecular Properties
| Compound Name | methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one |
| PubChem CID | 160854599 |
| Molecular Formula | C20H22O4 |
| Molecular Weight | 326.39 g/mol |
| Exact Mass | 326.15 |
| IUPAC Name | methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one |
| SMILES | CCC(=O)c1ccccc1.COC(=O)CC(=O)c1ccccc1C |
| InChI | InChI=1S/C11H12O3.C9H10O/c1-8-5-3-4-6-9(8)10(12)7-11(13)14-2;1-2-9(10)8-6-4-3-5-7-8/h3-6H,7H2,1-2H3;3-7H,2H2,1H3 |
| InChIKey | SJRWRDOOTUNHKP-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.39 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one?
The IUPAC name of methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one (CID 160854599) is methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one.
What is the SMILES notation for methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one?
The canonical SMILES for methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one is CCC(=O)c1ccccc1.COC(=O)CC(=O)c1ccccc1C.
What is the InChIKey of methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one?
The InChIKey is SJRWRDOOTUNHKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O3.C9H10O/c1-8-5-3-4-6-9(8)10(12)7-11(13)14-2;1-2-9(10)8-6-4-3-5-7-8/h3-6H,7H2,1-2H3;3-7H,2H2,1H3.
What are the key properties of methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one?
methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one has a molecular weight of 326.39 g/mol, XLogP of 4.02, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(2-methylphenyl)-3-oxopropanoate;1-phenylpropan-1-one is sourced from PubChem (CID 160854599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).