methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid

C18H18O5S — CID 70453659

IUPACmethane;naphthalen-1-yl(phenyl)methanone;sulfuric acid
SMILESC.O=C(c1ccccc1)c1cccc2ccccc12.O=S(=O)(O)O
InChIInChI=1S/C17H12O.CH4.H2O4S/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16;;1-5(2,3)4/h1-12H;1H4;(H2,1,2,3,4)
InChIKeyZIQUGNKJVWNXED-UHFFFAOYSA-N
MW346.40 g/mol
LogP4.05
Rot. Bonds2

About methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid

methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid (PubChem CID 70453659) has the molecular formula C18H18O5S and a molecular weight of 346.40 g/mol. Its IUPAC name is methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid.

Molecular Properties

Compound Namemethane;naphthalen-1-yl(phenyl)methanone;sulfuric acid
PubChem CID70453659
Molecular FormulaC18H18O5S
Molecular Weight346.40 g/mol
Exact Mass346.09
IUPAC Namemethane;naphthalen-1-yl(phenyl)methanone;sulfuric acid
SMILESC.O=C(c1ccccc1)c1cccc2ccccc12.O=S(=O)(O)O
InChIInChI=1S/C17H12O.CH4.H2O4S/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16;;1-5(2,3)4/h1-12H;1H4;(H2,1,2,3,4)
InChIKeyZIQUGNKJVWNXED-UHFFFAOYSA-N
XLogP4.05
TPSA91.67 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms24
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500346.40
LogP ≤ 54.05
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid?
The IUPAC name of methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid (CID 70453659) is methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid.
What is the SMILES notation for methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid?
The canonical SMILES for methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid is C.O=C(c1ccccc1)c1cccc2ccccc12.O=S(=O)(O)O.
What is the InChIKey of methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid?
The InChIKey is ZIQUGNKJVWNXED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O.CH4.H2O4S/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16;;1-5(2,3)4/h1-12H;1H4;(H2,1,2,3,4).
What are the key properties of methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid?
methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid has a molecular weight of 346.40 g/mol, XLogP of 4.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid is sourced from PubChem (CID 70453659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).