About methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid
methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid (PubChem CID 70453659) has the molecular formula C18H18O5S
and a molecular weight of 346.40 g/mol. Its IUPAC name is methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid.
Molecular Properties
| Compound Name | methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid |
| PubChem CID | 70453659 |
| Molecular Formula | C18H18O5S |
| Molecular Weight | 346.40 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid |
| SMILES | C.O=C(c1ccccc1)c1cccc2ccccc12.O=S(=O)(O)O |
| InChI | InChI=1S/C17H12O.CH4.H2O4S/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16;;1-5(2,3)4/h1-12H;1H4;(H2,1,2,3,4) |
| InChIKey | ZIQUGNKJVWNXED-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 91.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.40 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid?
The IUPAC name of methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid (CID 70453659) is methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid.
What is the SMILES notation for methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid?
The canonical SMILES for methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid is C.O=C(c1ccccc1)c1cccc2ccccc12.O=S(=O)(O)O.
What is the InChIKey of methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid?
The InChIKey is ZIQUGNKJVWNXED-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O.CH4.H2O4S/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16;;1-5(2,3)4/h1-12H;1H4;(H2,1,2,3,4).
What are the key properties of methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid?
methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid has a molecular weight of 346.40 g/mol, XLogP of 4.05, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;naphthalen-1-yl(phenyl)methanone;sulfuric acid is sourced from PubChem (CID 70453659), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).