2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid

C12H10O7S2 — CID 87145288

IUPAC2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid
SMILESO=C(c1cccc2ccccc12)C(S(=O)(=O)O)S(=O)(=O)O
InChIInChI=1S/C12H10O7S2/c13-11(12(20(14,15)16)21(17,18)19)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,12H,(H,14,15,16)(H,17,18,19)
InChIKeyLEFNDEZGBHJEMD-UHFFFAOYSA-N
MW330.34 g/mol
LogP1.12
Rot. Bonds4

About 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid

2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid (PubChem CID 87145288) has the molecular formula C12H10O7S2 and a molecular weight of 330.34 g/mol. Its IUPAC name is 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid.

Molecular Properties

Compound Name2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid
PubChem CID87145288
Molecular FormulaC12H10O7S2
Molecular Weight330.34 g/mol
Exact Mass329.99
IUPAC Name2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid
SMILESO=C(c1cccc2ccccc12)C(S(=O)(=O)O)S(=O)(=O)O
InChIInChI=1S/C12H10O7S2/c13-11(12(20(14,15)16)21(17,18)19)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,12H,(H,14,15,16)(H,17,18,19)
InChIKeyLEFNDEZGBHJEMD-UHFFFAOYSA-N
XLogP1.12
TPSA125.81 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds4
Heavy Atoms21
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500330.34
LogP ≤ 51.12
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid?
The IUPAC name of 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid (CID 87145288) is 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid.
What is the SMILES notation for 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid?
The canonical SMILES for 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid is O=C(c1cccc2ccccc12)C(S(=O)(=O)O)S(=O)(=O)O.
What is the InChIKey of 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid?
The InChIKey is LEFNDEZGBHJEMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10O7S2/c13-11(12(20(14,15)16)21(17,18)19)10-7-3-5-8-4-1-2-6-9(8)10/h1-7,12H,(H,14,15,16)(H,17,18,19).
What are the key properties of 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid?
2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid has a molecular weight of 330.34 g/mol, XLogP of 1.12, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-naphthalen-1-yl-2-oxoethane-1,1-disulfonic acid is sourced from PubChem (CID 87145288), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).