About 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene
1,2-dimethylhydrazine;diphenylmethanone;phenanthrene (PubChem CID 160628551) has the molecular formula C29H28N2O
and a molecular weight of 420.56 g/mol. Its IUPAC name is 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene.
Molecular Properties
| Compound Name | 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene |
| PubChem CID | 160628551 |
| Molecular Formula | C29H28N2O |
| Molecular Weight | 420.56 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene |
| SMILES | CNNC.O=C(c1ccccc1)c1ccccc1.c1ccc2c(c1)ccc1ccccc12 |
| InChI | InChI=1S/C14H10.C13H10O.C2H8N2/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-4-2/h2*1-10H;3-4H,1-2H3 |
| InChIKey | RHPVXWRBXSVUKA-UHFFFAOYSA-N |
| XLogP | 6.25 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 420.56 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene?
The IUPAC name of 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene (CID 160628551) is 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene.
What is the SMILES notation for 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene?
The canonical SMILES for 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene is CNNC.O=C(c1ccccc1)c1ccccc1.c1ccc2c(c1)ccc1ccccc12.
What is the InChIKey of 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene?
The InChIKey is RHPVXWRBXSVUKA-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10.C13H10O.C2H8N2/c1-3-7-13-11(5-1)9-10-12-6-2-4-8-14(12)13;14-13(11-7-3-1-4-8-11)12-9-5-2-6-10-12;1-3-4-2/h2*1-10H;3-4H,1-2H3.
What are the key properties of 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene?
1,2-dimethylhydrazine;diphenylmethanone;phenanthrene has a molecular weight of 420.56 g/mol, XLogP of 6.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dimethylhydrazine;diphenylmethanone;phenanthrene is sourced from PubChem (CID 160628551), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).