About methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone
methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone (PubChem CID 174806443) has the molecular formula C24H20O3S
and a molecular weight of 388.49 g/mol. Its IUPAC name is methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone.
Molecular Properties
| Compound Name | methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone |
| PubChem CID | 174806443 |
| Molecular Formula | C24H20O3S |
| Molecular Weight | 388.49 g/mol |
| Exact Mass | 388.11 |
| IUPAC Name | methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone |
| SMILES | CS(=O)(=O)c1ccccc1.O=C(c1ccccc1)c1cccc2ccccc12 |
| InChI | InChI=1S/C17H12O.C7H8O2S/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16;1-10(8,9)7-5-3-2-4-6-7/h1-12H;2-6H,1H3 |
| InChIKey | CQCWVAYRSOXMRD-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 388.49 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone?
The IUPAC name of methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone (CID 174806443) is methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone.
What is the SMILES notation for methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone?
The canonical SMILES for methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone is CS(=O)(=O)c1ccccc1.O=C(c1ccccc1)c1cccc2ccccc12.
What is the InChIKey of methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone?
The InChIKey is CQCWVAYRSOXMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12O.C7H8O2S/c18-17(14-8-2-1-3-9-14)16-12-6-10-13-7-4-5-11-15(13)16;1-10(8,9)7-5-3-2-4-6-7/h1-12H;2-6H,1H3.
What are the key properties of methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone?
methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone has a molecular weight of 388.49 g/mol, XLogP of 5.16, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methylsulfonylbenzene;naphthalen-1-yl(phenyl)methanone is sourced from PubChem (CID 174806443), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).