About carbonofluoridic acid;methylsulfonylbenzene
carbonofluoridic acid;methylsulfonylbenzene (PubChem CID 174721962) has the molecular formula C8H9FO4S
and a molecular weight of 220.22 g/mol. Its IUPAC name is carbonofluoridic acid;methylsulfonylbenzene.
Molecular Properties
| Compound Name | carbonofluoridic acid;methylsulfonylbenzene |
| PubChem CID | 174721962 |
| Molecular Formula | C8H9FO4S |
| Molecular Weight | 220.22 g/mol |
| Exact Mass | 220.02 |
| IUPAC Name | carbonofluoridic acid;methylsulfonylbenzene |
| SMILES | CS(=O)(=O)c1ccccc1.O=C(O)F |
| InChI | InChI=1S/C7H8O2S.CHFO2/c1-10(8,9)7-5-3-2-4-6-7;2-1(3)4/h2-6H,1H3;(H,3,4) |
| InChIKey | KOPIHJCAAMQGPQ-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze carbonofluoridic acid;methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonofluoridic acid;methylsulfonylbenzene?
The IUPAC name of carbonofluoridic acid;methylsulfonylbenzene (CID 174721962) is carbonofluoridic acid;methylsulfonylbenzene.
What is the SMILES notation for carbonofluoridic acid;methylsulfonylbenzene?
The canonical SMILES for carbonofluoridic acid;methylsulfonylbenzene is CS(=O)(=O)c1ccccc1.O=C(O)F.
What is the InChIKey of carbonofluoridic acid;methylsulfonylbenzene?
The InChIKey is KOPIHJCAAMQGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S.CHFO2/c1-10(8,9)7-5-3-2-4-6-7;2-1(3)4/h2-6H,1H3;(H,3,4).
What are the key properties of carbonofluoridic acid;methylsulfonylbenzene?
carbonofluoridic acid;methylsulfonylbenzene has a molecular weight of 220.22 g/mol, XLogP of 1.72, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for carbonofluoridic acid;methylsulfonylbenzene is sourced from PubChem (CID 174721962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).