About methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene
methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene (PubChem CID 158947409) has the molecular formula C12H21NO2S
and a molecular weight of 243.37 g/mol. Its IUPAC name is methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene.
Molecular Properties
| Compound Name | methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene |
| PubChem CID | 158947409 |
| Molecular Formula | C12H21NO2S |
| Molecular Weight | 243.37 g/mol |
| Exact Mass | 243.13 |
| IUPAC Name | methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene |
| SMILES | C.CC=CNC.CS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C7H8O2S.C4H9N.CH4/c1-10(8,9)7-5-3-2-4-6-7;1-3-4-5-2;/h2-6H,1H3;3-5H,1-2H3;1H4 |
| InChIKey | JKZMNXIPKDBCKE-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.37 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene?
The IUPAC name of methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene (CID 158947409) is methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene.
What is the SMILES notation for methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene?
The canonical SMILES for methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene is C.CC=CNC.CS(=O)(=O)c1ccccc1.
What is the InChIKey of methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene?
The InChIKey is JKZMNXIPKDBCKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8O2S.C4H9N.CH4/c1-10(8,9)7-5-3-2-4-6-7;1-3-4-5-2;/h2-6H,1H3;3-5H,1-2H3;1H4.
What are the key properties of methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene?
methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene has a molecular weight of 243.37 g/mol, XLogP of 2.47, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methane;N-methylprop-1-en-1-amine;methylsulfonylbenzene is sourced from PubChem (CID 158947409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).