C14H20O2S — CID 143718879
ethane;5-methyl-1-methylsulfonylcyclodeca-1,3,5,7,9-pentaene (PubChem CID 143718879) has the molecular formula C14H20O2S and a molecular weight of 252.38 g/mol. Its IUPAC name is ethane;5-methyl-1-methylsulfonylcyclodeca-1,3,5,7,9-pentaene.
| Compound Name | ethane;5-methyl-1-methylsulfonylcyclodeca-1,3,5,7,9-pentaene |
|---|---|
| PubChem CID | 143718879 |
| Molecular Formula | C14H20O2S |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | ethane;5-methyl-1-methylsulfonylcyclodeca-1,3,5,7,9-pentaene |
| SMILES | CC.Cc1cccccc(S(C)(=O)=O)ccc1 |
| InChI | InChI=1S/C12H14O2S.C2H6/c1-11-7-4-3-5-9-12(10-6-8-11)15(2,13)14;1-2/h3-10H,1-2H3;1-2H3/b4-3-,5-3+,7-4-,8-6+,9-5+,10-6-,11-7-,11-8+,12-9+,12-10+; |
| InChIKey | BSBHAJAQYZWHPV-BWAMKJIGSA-N |
| XLogP | 3.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |