About dichloromethane;1-methyl-4-methylsulfonylbenzene
dichloromethane;1-methyl-4-methylsulfonylbenzene (PubChem CID 175095378) has the molecular formula C9H12Cl2O2S
and a molecular weight of 255.17 g/mol. Its IUPAC name is dichloromethane;1-methyl-4-methylsulfonylbenzene.
Molecular Properties
| Compound Name | dichloromethane;1-methyl-4-methylsulfonylbenzene |
| PubChem CID | 175095378 |
| Molecular Formula | C9H12Cl2O2S |
| Molecular Weight | 255.17 g/mol |
| Exact Mass | 253.99 |
| IUPAC Name | dichloromethane;1-methyl-4-methylsulfonylbenzene |
| SMILES | Cc1ccc(S(C)(=O)=O)cc1.ClCCl |
| InChI | InChI=1S/C8H10O2S.CH2Cl2/c1-7-3-5-8(6-4-7)11(2,9)10;2-1-3/h3-6H,1-2H3;1H2 |
| InChIKey | ILBUUWICXPFAFI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 255.17 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze dichloromethane;1-methyl-4-methylsulfonylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloromethane;1-methyl-4-methylsulfonylbenzene?
The IUPAC name of dichloromethane;1-methyl-4-methylsulfonylbenzene (CID 175095378) is dichloromethane;1-methyl-4-methylsulfonylbenzene.
What is the SMILES notation for dichloromethane;1-methyl-4-methylsulfonylbenzene?
The canonical SMILES for dichloromethane;1-methyl-4-methylsulfonylbenzene is Cc1ccc(S(C)(=O)=O)cc1.ClCCl.
What is the InChIKey of dichloromethane;1-methyl-4-methylsulfonylbenzene?
The InChIKey is ILBUUWICXPFAFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O2S.CH2Cl2/c1-7-3-5-8(6-4-7)11(2,9)10;2-1-3/h3-6H,1-2H3;1H2.
What are the key properties of dichloromethane;1-methyl-4-methylsulfonylbenzene?
dichloromethane;1-methyl-4-methylsulfonylbenzene has a molecular weight of 255.17 g/mol, XLogP of 2.82, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for dichloromethane;1-methyl-4-methylsulfonylbenzene is sourced from PubChem (CID 175095378), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).