C16H19NO2S2 — CID 64628350
1-(4-methylphenyl)-2-(4-methylsulfonylphenyl)sulfanylethanamine (PubChem CID 64628350) has the molecular formula C16H19NO2S2 and a molecular weight of 321.47 g/mol. Its IUPAC name is 1-(4-methylphenyl)-2-(4-methylsulfonylphenyl)sulfanylethanamine.
| Compound Name | 1-(4-methylphenyl)-2-(4-methylsulfonylphenyl)sulfanylethanamine |
|---|---|
| PubChem CID | 64628350 |
| Molecular Formula | C16H19NO2S2 |
| Molecular Weight | 321.47 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 1-(4-methylphenyl)-2-(4-methylsulfonylphenyl)sulfanylethanamine |
| SMILES | Cc1ccc(C(N)CSc2ccc(S(C)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C16H19NO2S2/c1-12-3-5-13(6-4-12)16(17)11-20-14-7-9-15(10-8-14)21(2,18)19/h3-10,16H,11,17H2,1-2H3 |
| InChIKey | XDEPWCPFDYHUKH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |