C13H21NO2S2 — CID 64625979
3,3-dimethyl-1-(4-methylsulfonylphenyl)sulfanylbutan-2-amine (PubChem CID 64625979) has the molecular formula C13H21NO2S2 and a molecular weight of 287.45 g/mol. Its IUPAC name is 3,3-dimethyl-1-(4-methylsulfonylphenyl)sulfanylbutan-2-amine.
| Compound Name | 3,3-dimethyl-1-(4-methylsulfonylphenyl)sulfanylbutan-2-amine |
|---|---|
| PubChem CID | 64625979 |
| Molecular Formula | C13H21NO2S2 |
| Molecular Weight | 287.45 g/mol |
| Exact Mass | 287.10 |
| IUPAC Name | 3,3-dimethyl-1-(4-methylsulfonylphenyl)sulfanylbutan-2-amine |
| SMILES | CC(C)(C)C(N)CSc1ccc(S(C)(=O)=O)cc1 |
| InChI | InChI=1S/C13H21NO2S2/c1-13(2,3)12(14)9-17-10-5-7-11(8-6-10)18(4,15)16/h5-8,12H,9,14H2,1-4H3 |
| InChIKey | XZJUVBDYTVGIMS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.45 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |