C12H18N2O2S — CID 64609514
3,3-dimethyl-1-(2-nitrophenyl)sulfanylbutan-2-amine (PubChem CID 64609514) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is 3,3-dimethyl-1-(2-nitrophenyl)sulfanylbutan-2-amine.
| Compound Name | 3,3-dimethyl-1-(2-nitrophenyl)sulfanylbutan-2-amine |
|---|---|
| PubChem CID | 64609514 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | 3,3-dimethyl-1-(2-nitrophenyl)sulfanylbutan-2-amine |
| SMILES | CC(C)(C)C(N)CSc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H18N2O2S/c1-12(2,3)11(13)8-17-10-7-5-4-6-9(10)14(15)16/h4-7,11H,8,13H2,1-3H3 |
| InChIKey | FNXONOWLJYQEDQ-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|