C11H16N2O2 — CID 131529509
(1R)-2,2-dimethyl-1-(2-nitrophenyl)propan-1-amine (PubChem CID 131529509) has the molecular formula C11H16N2O2 and a molecular weight of 208.26 g/mol. Its IUPAC name is (1R)-2,2-dimethyl-1-(2-nitrophenyl)propan-1-amine.
| Compound Name | (1R)-2,2-dimethyl-1-(2-nitrophenyl)propan-1-amine |
|---|---|
| PubChem CID | 131529509 |
| Molecular Formula | C11H16N2O2 |
| Molecular Weight | 208.26 g/mol |
| Exact Mass | 208.12 |
| IUPAC Name | (1R)-2,2-dimethyl-1-(2-nitrophenyl)propan-1-amine |
| SMILES | CC(C)(C)[C@@H](N)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16N2O2/c1-11(2,3)10(12)8-6-4-5-7-9(8)13(14)15/h4-7,10H,12H2,1-3H3/t10-/m0/s1 |
| InChIKey | YFPIJUDAUABOCS-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.26 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|