C9H7F5N2O2 — CID 171311381
(1S)-2,2,3,3,3-pentafluoro-1-(2-nitrophenyl)propan-1-amine (PubChem CID 171311381) has the molecular formula C9H7F5N2O2 and a molecular weight of 270.16 g/mol. Its IUPAC name is (1S)-2,2,3,3,3-pentafluoro-1-(2-nitrophenyl)propan-1-amine.
| Compound Name | (1S)-2,2,3,3,3-pentafluoro-1-(2-nitrophenyl)propan-1-amine |
|---|---|
| PubChem CID | 171311381 |
| Molecular Formula | C9H7F5N2O2 |
| Molecular Weight | 270.16 g/mol |
| Exact Mass | 270.04 |
| IUPAC Name | (1S)-2,2,3,3,3-pentafluoro-1-(2-nitrophenyl)propan-1-amine |
| SMILES | N[C@@H](c1ccccc1[N+](=O)[O-])C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H7F5N2O2/c10-8(11,9(12,13)14)7(15)5-3-1-2-4-6(5)16(17)18/h1-4,7H,15H2/t7-/m0/s1 |
| InChIKey | CYUULELVYXZXTI-ZETCQYMHSA-N |
| XLogP | 2.79 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.16 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|