C9H14ClN3O2 — CID 171217794
(1S)-1-(2-nitrophenyl)propane-1,3-diamine;hydrochloride (PubChem CID 171217794) has the molecular formula C9H14ClN3O2 and a molecular weight of 231.68 g/mol. Its IUPAC name is (1S)-1-(2-nitrophenyl)propane-1,3-diamine;hydrochloride.
| Compound Name | (1S)-1-(2-nitrophenyl)propane-1,3-diamine;hydrochloride |
|---|---|
| PubChem CID | 171217794 |
| Molecular Formula | C9H14ClN3O2 |
| Molecular Weight | 231.68 g/mol |
| Exact Mass | 231.08 |
| IUPAC Name | (1S)-1-(2-nitrophenyl)propane-1,3-diamine;hydrochloride |
| SMILES | Cl.NCC[C@H](N)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H13N3O2.ClH/c10-6-5-8(11)7-3-1-2-4-9(7)12(13)14;/h1-4,8H,5-6,10-11H2;1H/t8-;/m0./s1 |
| InChIKey | QBIWPYBLFKAKRS-QRPNPIFTSA-N |
| XLogP | 1.37 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.68 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|