C11H17Cl2N3O2 — CID 171225953
(1S)-1-(5-chloro-2-nitrophenyl)pentane-1,5-diamine;hydrochloride (PubChem CID 171225953) has the molecular formula C11H17Cl2N3O2 and a molecular weight of 294.18 g/mol. Its IUPAC name is (1S)-1-(5-chloro-2-nitrophenyl)pentane-1,5-diamine;hydrochloride.
| Compound Name | (1S)-1-(5-chloro-2-nitrophenyl)pentane-1,5-diamine;hydrochloride |
|---|---|
| PubChem CID | 171225953 |
| Molecular Formula | C11H17Cl2N3O2 |
| Molecular Weight | 294.18 g/mol |
| Exact Mass | 293.07 |
| IUPAC Name | (1S)-1-(5-chloro-2-nitrophenyl)pentane-1,5-diamine;hydrochloride |
| SMILES | Cl.NCCCC[C@H](N)c1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H16ClN3O2.ClH/c12-8-4-5-11(15(16)17)9(7-8)10(14)3-1-2-6-13;/h4-5,7,10H,1-3,6,13-14H2;1H/t10-;/m0./s1 |
| InChIKey | HULZUAPEHPZBCT-PPHPATTJSA-N |
| XLogP | 2.80 |
| TPSA | 95.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.18 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|