C9H12N2O3 — CID 55270082
(1S,2S)-1-amino-1-(2-nitrophenyl)propan-2-ol (PubChem CID 55270082) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is (1S,2S)-1-amino-1-(2-nitrophenyl)propan-2-ol.
| Compound Name | (1S,2S)-1-amino-1-(2-nitrophenyl)propan-2-ol |
|---|---|
| PubChem CID | 55270082 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | (1S,2S)-1-amino-1-(2-nitrophenyl)propan-2-ol |
| SMILES | C[C@H](O)[C@@H](N)c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H12N2O3/c1-6(12)9(10)7-4-2-3-5-8(7)11(13)14/h2-6,9,12H,10H2,1H3/t6-,9+/m0/s1 |
| InChIKey | WLCAQIOKMONSOX-IMTBSYHQSA-N |
| XLogP | 0.98 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|