C11H12ClF5N2O4 — CID 171311935
(1S)-1-(4,5-dimethoxy-2-nitrophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride (PubChem CID 171311935) has the molecular formula C11H12ClF5N2O4 and a molecular weight of 366.67 g/mol. Its IUPAC name is (1S)-1-(4,5-dimethoxy-2-nitrophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride.
| Compound Name | (1S)-1-(4,5-dimethoxy-2-nitrophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171311935 |
| Molecular Formula | C11H12ClF5N2O4 |
| Molecular Weight | 366.67 g/mol |
| Exact Mass | 366.04 |
| IUPAC Name | (1S)-1-(4,5-dimethoxy-2-nitrophenyl)-2,2,3,3,3-pentafluoropropan-1-amine;hydrochloride |
| SMILES | COc1cc([C@H](N)C(F)(F)C(F)(F)F)c([N+](=O)[O-])cc1OC.Cl |
| InChI | InChI=1S/C11H11F5N2O4.ClH/c1-21-7-3-5(6(18(19)20)4-8(7)22-2)9(17)10(12,13)11(14,15)16;/h3-4,9H,17H2,1-2H3;1H/t9-;/m0./s1 |
| InChIKey | AWLPMJHBIMUKMT-FVGYRXGTSA-N |
| XLogP | 3.23 |
| TPSA | 87.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.67 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|