C11H15FN2O2 — CID 131466473
(1S)-1-(5-fluoro-2-nitrophenyl)-2,2-dimethylpropan-1-amine (PubChem CID 131466473) has the molecular formula C11H15FN2O2 and a molecular weight of 226.25 g/mol. Its IUPAC name is (1S)-1-(5-fluoro-2-nitrophenyl)-2,2-dimethylpropan-1-amine.
| Compound Name | (1S)-1-(5-fluoro-2-nitrophenyl)-2,2-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 131466473 |
| Molecular Formula | C11H15FN2O2 |
| Molecular Weight | 226.25 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | (1S)-1-(5-fluoro-2-nitrophenyl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)[C@H](N)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C11H15FN2O2/c1-11(2,3)10(13)8-6-7(12)4-5-9(8)14(15)16/h4-6,10H,13H2,1-3H3/t10-/m1/s1 |
| InChIKey | RLTOZQZICWITRD-SNVBAGLBSA-N |
| XLogP | 2.78 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.25 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|