C12H18ClFN2O2 — CID 171206039
(1R)-1-(5-fluoro-2-nitrophenyl)-4-methylpentan-1-amine;hydrochloride (PubChem CID 171206039) has the molecular formula C12H18ClFN2O2 and a molecular weight of 276.74 g/mol. Its IUPAC name is (1R)-1-(5-fluoro-2-nitrophenyl)-4-methylpentan-1-amine;hydrochloride.
| Compound Name | (1R)-1-(5-fluoro-2-nitrophenyl)-4-methylpentan-1-amine;hydrochloride |
|---|---|
| PubChem CID | 171206039 |
| Molecular Formula | C12H18ClFN2O2 |
| Molecular Weight | 276.74 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (1R)-1-(5-fluoro-2-nitrophenyl)-4-methylpentan-1-amine;hydrochloride |
| SMILES | CC(C)CC[C@@H](N)c1cc(F)ccc1[N+](=O)[O-].Cl |
| InChI | InChI=1S/C12H17FN2O2.ClH/c1-8(2)3-5-11(14)10-7-9(13)4-6-12(10)15(16)17;/h4,6-8,11H,3,5,14H2,1-2H3;1H/t11-;/m1./s1 |
| InChIKey | WKDRJHQCIKIPOD-RFVHGSKJSA-N |
| XLogP | 3.59 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.74 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|