C13H19FN2O3 — CID 171268403
(1S,2R)-1-amino-1-(5-fluoro-2-nitrophenyl)-5-methylhexan-2-ol (PubChem CID 171268403) has the molecular formula C13H19FN2O3 and a molecular weight of 270.30 g/mol. Its IUPAC name is (1S,2R)-1-amino-1-(5-fluoro-2-nitrophenyl)-5-methylhexan-2-ol.
| Compound Name | (1S,2R)-1-amino-1-(5-fluoro-2-nitrophenyl)-5-methylhexan-2-ol |
|---|---|
| PubChem CID | 171268403 |
| Molecular Formula | C13H19FN2O3 |
| Molecular Weight | 270.30 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | (1S,2R)-1-amino-1-(5-fluoro-2-nitrophenyl)-5-methylhexan-2-ol |
| SMILES | CC(C)CC[C@@H](O)[C@@H](N)c1cc(F)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19FN2O3/c1-8(2)3-6-12(17)13(15)10-7-9(14)4-5-11(10)16(18)19/h4-5,7-8,12-13,17H,3,6,15H2,1-2H3/t12-,13+/m1/s1 |
| InChIKey | IDJCPPANKNMULH-OLZOCXBDSA-N |
| XLogP | 2.53 |
| TPSA | 89.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.30 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|